C21H17F6N3O6 — CID 10481817
10-(2-amino-1-hydroxyethyl)-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-12-ol;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10481817) has the molecular formula C21H17F6N3O6 and a molecular weight of 521.37 g/mol. Its IUPAC name is 10-(2-amino-1-hydroxyethyl)-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-12-ol;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 10-(2-amino-1-hydroxyethyl)-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-12-ol;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10481817 |
| Molecular Formula | C21H17F6N3O6 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 10-(2-amino-1-hydroxyethyl)-8,14-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-12-ol;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NCC(O)c1cc(O)c2nccc3c2c1Nc1ccccc1-3.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H15N3O2.2C2HF3O2/c18-8-14(22)11-7-13(21)17-15-10(5-6-19-17)9-3-1-2-4-12(9)20-16(11)15;2*3-2(4,5)1(6)7/h1-7,14,20-22H,8,18H2;2*(H,6,7) |
| InChIKey | LJEFWYKJAFMBEW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|