About 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea
1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea (PubChem CID 104818432) has the molecular formula C6H11N5O2
and a molecular weight of 185.19 g/mol. Its IUPAC name is 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea.
Molecular Properties
| Compound Name | 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea |
| PubChem CID | 104818432 |
| Molecular Formula | C6H11N5O2 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea |
| SMILES | CCOc1n[nH]c(NC(=O)NC)n1 |
| InChI | InChI=1S/C6H11N5O2/c1-3-13-6-9-4(10-11-6)8-5(12)7-2/h3H2,1-2H3,(H3,7,8,9,10,11,12) |
| InChIKey | AWFBZQPPPCDKFL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
The IUPAC name of 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea (CID 104818432) is 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea.
What is the SMILES notation for 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
The canonical SMILES for 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea is CCOc1n[nH]c(NC(=O)NC)n1.
What is the InChIKey of 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
The InChIKey is AWFBZQPPPCDKFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O2/c1-3-13-6-9-4(10-11-6)8-5(12)7-2/h3H2,1-2H3,(H3,7,8,9,10,11,12).
What are the key properties of 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea?
1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea has a molecular weight of 185.19 g/mol, XLogP of -0.05, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-1H-1,2,4-triazol-5-yl)-3-methylurea is sourced from PubChem (CID 104818432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).