C7H13N5O2 — CID 104818438
3-(3-ethoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea (PubChem CID 104818438) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-(3-ethoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea.
| Compound Name | 3-(3-ethoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 104818438 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-(3-ethoxy-1H-1,2,4-triazol-5-yl)-1,1-dimethylurea |
| SMILES | CCOc1n[nH]c(NC(=O)N(C)C)n1 |
| InChI | InChI=1S/C7H13N5O2/c1-4-14-6-8-5(10-11-6)9-7(13)12(2)3/h4H2,1-3H3,(H2,8,9,10,11,13) |
| InChIKey | LEVNBMFGBBZBGH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |