About (3-ethoxy-1H-1,2,4-triazol-5-yl)urea
(3-ethoxy-1H-1,2,4-triazol-5-yl)urea (PubChem CID 104818440) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is (3-ethoxy-1H-1,2,4-triazol-5-yl)urea.
Molecular Properties
| Compound Name | (3-ethoxy-1H-1,2,4-triazol-5-yl)urea |
| PubChem CID | 104818440 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | (3-ethoxy-1H-1,2,4-triazol-5-yl)urea |
| SMILES | CCOc1n[nH]c(NC(N)=O)n1 |
| InChI | InChI=1S/C5H9N5O2/c1-2-12-5-8-4(9-10-5)7-3(6)11/h2H2,1H3,(H4,6,7,8,9,10,11) |
| InChIKey | DGLLXDOYYQDBAW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-ethoxy-1H-1,2,4-triazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-1H-1,2,4-triazol-5-yl)urea?
The IUPAC name of (3-ethoxy-1H-1,2,4-triazol-5-yl)urea (CID 104818440) is (3-ethoxy-1H-1,2,4-triazol-5-yl)urea.
What is the SMILES notation for (3-ethoxy-1H-1,2,4-triazol-5-yl)urea?
The canonical SMILES for (3-ethoxy-1H-1,2,4-triazol-5-yl)urea is CCOc1n[nH]c(NC(N)=O)n1.
What is the InChIKey of (3-ethoxy-1H-1,2,4-triazol-5-yl)urea?
The InChIKey is DGLLXDOYYQDBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O2/c1-2-12-5-8-4(9-10-5)7-3(6)11/h2H2,1H3,(H4,6,7,8,9,10,11).
What are the key properties of (3-ethoxy-1H-1,2,4-triazol-5-yl)urea?
(3-ethoxy-1H-1,2,4-triazol-5-yl)urea has a molecular weight of 171.16 g/mol, XLogP of -0.31, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-1H-1,2,4-triazol-5-yl)urea is sourced from PubChem (CID 104818440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).