C14H19ClN2O2 — CID 104818739
5-amino-6-(2-chloro-6-methoxyphenyl)-1-ethylpiperidin-2-one (PubChem CID 104818739) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 5-amino-6-(2-chloro-6-methoxyphenyl)-1-ethylpiperidin-2-one.
| Compound Name | 5-amino-6-(2-chloro-6-methoxyphenyl)-1-ethylpiperidin-2-one |
|---|---|
| PubChem CID | 104818739 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 5-amino-6-(2-chloro-6-methoxyphenyl)-1-ethylpiperidin-2-one |
| SMILES | CCN1C(=O)CCC(N)C1c1c(Cl)cccc1OC |
| InChI | InChI=1S/C14H19ClN2O2/c1-3-17-12(18)8-7-10(16)14(17)13-9(15)5-4-6-11(13)19-2/h4-6,10,14H,3,7-8,16H2,1-2H3 |
| InChIKey | UPGOHGMFTQXITR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |