C9H12N4O2 — CID 104818832
2-ethoxy-5-ethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 104818832) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-ethoxy-5-ethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2-ethoxy-5-ethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 104818832 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-ethoxy-5-ethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCOc1nc2nc(CC)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C9H12N4O2/c1-3-6-5-7(14)13-8(10-6)11-9(12-13)15-4-2/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | SCNLDRFVDUPIPX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |