C12H14ClNO2 — CID 104819040
2-[(2-chloro-6-methoxyphenyl)-hydroxymethyl]butanenitrile (PubChem CID 104819040) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 2-[(2-chloro-6-methoxyphenyl)-hydroxymethyl]butanenitrile.
| Compound Name | 2-[(2-chloro-6-methoxyphenyl)-hydroxymethyl]butanenitrile |
|---|---|
| PubChem CID | 104819040 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-[(2-chloro-6-methoxyphenyl)-hydroxymethyl]butanenitrile |
| SMILES | CCC(C#N)C(O)c1c(Cl)cccc1OC |
| InChI | InChI=1S/C12H14ClNO2/c1-3-8(7-14)12(15)11-9(13)5-4-6-10(11)16-2/h4-6,8,12,15H,3H2,1-2H3 |
| InChIKey | XNVYYQGVQJTNRA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |