C19H21IN6O4 — CID 10481912
(2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide (PubChem CID 10481912) has the molecular formula C19H21IN6O4 and a molecular weight of 524.32 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 10481912 |
| Molecular Formula | C19H21IN6O4 |
| Molecular Weight | 524.32 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | (2S,3S,4R,5R)-N-ethyl-3,4-dihydroxy-5-[6-[(3-iodophenyl)methylamino]purin-9-yl]oxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCc4cccc(I)c4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21IN6O4/c1-2-21-18(29)15-13(27)14(28)19(30-15)26-9-25-12-16(23-8-24-17(12)26)22-7-10-4-3-5-11(20)6-10/h3-6,8-9,13-15,19,27-28H,2,7H2,1H3,(H,21,29)(H,22,23,24)/t13-,14+,15-,19+/m0/s1 |
| InChIKey | DVCZFHQLDLXEIA-QCUYGVNKSA-N |
| XLogP | 0.80 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|