C31H32N4O4 — CID 10481929
tert-butyl N-[11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-8-yl]carbamate (PubChem CID 10481929) has the molecular formula C31H32N4O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl N-[11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-8-yl]carbamate.
| Compound Name | tert-butyl N-[11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-8-yl]carbamate |
|---|---|
| PubChem CID | 10481929 |
| Molecular Formula | C31H32N4O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | tert-butyl N-[11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-8-yl]carbamate |
| SMILES | Cn1cc(C2=C(c3c4n(c5ccccc35)CCC(NC(=O)OC(C)(C)C)CC4)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C31H32N4O4/c1-31(2,3)39-30(38)32-18-13-14-24-25(20-10-6-8-12-23(20)35(24)16-15-18)27-26(28(36)33-29(27)37)21-17-34(4)22-11-7-5-9-19(21)22/h5-12,17-18H,13-16H2,1-4H3,(H,32,38)(H,33,36,37) |
| InChIKey | ZFLKBBPAICNBRH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|