C15H15BrN2O3 — CID 104819771
2-bromo-N-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-3-amine (PubChem CID 104819771) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-bromo-N-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-3-amine.
| Compound Name | 2-bromo-N-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 104819771 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-bromo-N-[(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-3-amine |
| SMILES | COc1cc(CNc2cccnc2Br)cc2c1OCCO2 |
| InChI | InChI=1S/C15H15BrN2O3/c1-19-12-7-10(8-13-14(12)21-6-5-20-13)9-18-11-3-2-4-17-15(11)16/h2-4,7-8,18H,5-6,9H2,1H3 |
| InChIKey | RSQZBDZLRGKPGL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|