About [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate
[3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate (PubChem CID 10482128) has the molecular formula C25H27N2O4+
and a molecular weight of 419.50 g/mol. Its IUPAC name is [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate.
Molecular Properties
| Compound Name | [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate |
| PubChem CID | 10482128 |
| Molecular Formula | C25H27N2O4+ |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate |
| SMILES | CN(C)C(=O)Oc1ccc[n+](C)c1COC(=O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N2O4/c1-25(19-12-7-5-8-13-19,20-14-9-6-10-15-20)23(28)30-18-21-22(16-11-17-27(21)4)31-24(29)26(2)3/h5-17H,18H2,1-4H3/q+1 |
| InChIKey | WHIMEOMPXHBKBV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate?
The IUPAC name of [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate (CID 10482128) is [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate.
What is the SMILES notation for [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate?
The canonical SMILES for [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate is CN(C)C(=O)Oc1ccc[n+](C)c1COC(=O)C(C)(c1ccccc1)c1ccccc1.
What is the InChIKey of [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate?
The InChIKey is WHIMEOMPXHBKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N2O4/c1-25(19-12-7-5-8-13-19,20-14-9-6-10-15-20)23(28)30-18-21-22(16-11-17-27(21)4)31-24(29)26(2)3/h5-17H,18H2,1-4H3/q+1.
What are the key properties of [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate?
[3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate has a molecular weight of 419.50 g/mol, XLogP of 3.62, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dimethylcarbamoyloxy)-1-methylpyridin-1-ium-2-yl]methyl 2,2-diphenylpropanoate is sourced from PubChem (CID 10482128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).