C13H11ClF2N2 — CID 104822073
2-chloro-4,6-difluoro-N-[(6-methyl-3-pyridinyl)methyl]aniline (PubChem CID 104822073) has the molecular formula C13H11ClF2N2 and a molecular weight of 268.69 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-[(6-methyl-3-pyridinyl)methyl]aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-[(6-methyl-3-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 104822073 |
| Molecular Formula | C13H11ClF2N2 |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-[(6-methyl-3-pyridinyl)methyl]aniline |
| SMILES | Cc1ccc(CNc2c(F)cc(F)cc2Cl)cn1 |
| InChI | InChI=1S/C13H11ClF2N2/c1-8-2-3-9(6-17-8)7-18-13-11(14)4-10(15)5-12(13)16/h2-6,18H,7H2,1H3 |
| InChIKey | DOZDPCPNSNXVJY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |