2-(methylamino)ethoxymethanedithioic acid

C4H9NOS2 — CID 10482262

IUPAC2-(methylamino)ethoxymethanedithioic acid
SMILESCNCCOC(=S)S
InChIInChI=1S/C4H9NOS2/c1-5-2-3-6-4(7)8/h5H,2-3H2,1H3,(H,7,8)
InChIKeyLNCFDRLXZZXVJF-UHFFFAOYSA-N
MW151.26 g/mol
LogP0.44
Rot. Bonds3

About 2-(methylamino)ethoxymethanedithioic acid

2-(methylamino)ethoxymethanedithioic acid (PubChem CID 10482262) has the molecular formula C4H9NOS2 and a molecular weight of 151.26 g/mol. Its IUPAC name is 2-(methylamino)ethoxymethanedithioic acid.

Molecular Properties

Compound Name2-(methylamino)ethoxymethanedithioic acid
PubChem CID10482262
Molecular FormulaC4H9NOS2
Molecular Weight151.26 g/mol
Exact Mass151.01
IUPAC Name2-(methylamino)ethoxymethanedithioic acid
SMILESCNCCOC(=S)S
InChIInChI=1S/C4H9NOS2/c1-5-2-3-6-4(7)8/h5H,2-3H2,1H3,(H,7,8)
InChIKeyLNCFDRLXZZXVJF-UHFFFAOYSA-N
XLogP0.44
TPSA21.26 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.26
LogP ≤ 50.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-(methylamino)ethoxymethanedithioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(methylamino)ethoxymethanedithioic acid?
The IUPAC name of 2-(methylamino)ethoxymethanedithioic acid (CID 10482262) is 2-(methylamino)ethoxymethanedithioic acid.
What is the SMILES notation for 2-(methylamino)ethoxymethanedithioic acid?
The canonical SMILES for 2-(methylamino)ethoxymethanedithioic acid is CNCCOC(=S)S.
What is the InChIKey of 2-(methylamino)ethoxymethanedithioic acid?
The InChIKey is LNCFDRLXZZXVJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NOS2/c1-5-2-3-6-4(7)8/h5H,2-3H2,1H3,(H,7,8).
What are the key properties of 2-(methylamino)ethoxymethanedithioic acid?
2-(methylamino)ethoxymethanedithioic acid has a molecular weight of 151.26 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethoxymethanedithioic acid is sourced from PubChem (CID 10482262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).