C30H37N3O4S — CID 10482276
N-[[(1S,2S,4R)-2-hydroxy-7,7-dimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl]pyridine-2-carboxamide (PubChem CID 10482276) has the molecular formula C30H37N3O4S and a molecular weight of 535.71 g/mol. Its IUPAC name is N-[[(1S,2S,4R)-2-hydroxy-7,7-dimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[(1S,2S,4R)-2-hydroxy-7,7-dimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 10482276 |
| Molecular Formula | C30H37N3O4S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | N-[[(1S,2S,4R)-2-hydroxy-7,7-dimethyl-1-(spiro[indene-1,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]methyl]pyridine-2-carboxamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N1CCC3(C=Cc4ccccc43)CC1)[C@](O)(CNC(=O)c1ccccn1)C2 |
| InChI | InChI=1S/C30H37N3O4S/c1-27(2)23-11-13-29(27,30(35,19-23)20-32-26(34)25-9-5-6-16-31-25)21-38(36,37)33-17-14-28(15-18-33)12-10-22-7-3-4-8-24(22)28/h3-10,12,16,23,35H,11,13-15,17-21H2,1-2H3,(H,32,34)/t23-,29+,30-/m1/s1 |
| InChIKey | IWWVICGUVNGTPR-GOQOSDJISA-N |
| XLogP | 3.76 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |