C13H15IN4 — CID 104823382
5-iodo-2-(6-methyl-3-pyridinyl)-6-propylpyrimidin-4-amine (PubChem CID 104823382) has the molecular formula C13H15IN4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 5-iodo-2-(6-methyl-3-pyridinyl)-6-propylpyrimidin-4-amine.
| Compound Name | 5-iodo-2-(6-methyl-3-pyridinyl)-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 104823382 |
| Molecular Formula | C13H15IN4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 5-iodo-2-(6-methyl-3-pyridinyl)-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(-c2ccc(C)nc2)nc(N)c1I |
| InChI | InChI=1S/C13H15IN4/c1-3-4-10-11(14)12(15)18-13(17-10)9-6-5-8(2)16-7-9/h5-7H,3-4H2,1-2H3,(H2,15,17,18) |
| InChIKey | SUTUYRNNZBRYMN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|