C14H22N2O2 — CID 104824308
methyl 2-amino-6-[[butan-2-yl(methyl)amino]methyl]benzoate (PubChem CID 104824308) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl 2-amino-6-[[butan-2-yl(methyl)amino]methyl]benzoate.
| Compound Name | methyl 2-amino-6-[[butan-2-yl(methyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 104824308 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | methyl 2-amino-6-[[butan-2-yl(methyl)amino]methyl]benzoate |
| SMILES | CCC(C)N(C)Cc1cccc(N)c1C(=O)OC |
| InChI | InChI=1S/C14H22N2O2/c1-5-10(2)16(3)9-11-7-6-8-12(15)13(11)14(17)18-4/h6-8,10H,5,9,15H2,1-4H3 |
| InChIKey | KVGNUVQLABLJNG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|