About methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate
methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate (PubChem CID 104824888) has the molecular formula C12H12N2O4S
and a molecular weight of 280.31 g/mol. Its IUPAC name is methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate |
| PubChem CID | 104824888 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate |
| SMILES | COC(=O)c1c(N)cccc1CN1C(=O)CSC1=O |
| InChI | InChI=1S/C12H12N2O4S/c1-18-11(16)10-7(3-2-4-8(10)13)5-14-9(15)6-19-12(14)17/h2-4H,5-6,13H2,1H3 |
| InChIKey | BTTLNOSUGYBSRC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate?
The IUPAC name of methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate (CID 104824888) is methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate.
What is the SMILES notation for methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate?
The canonical SMILES for methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate is COC(=O)c1c(N)cccc1CN1C(=O)CSC1=O.
What is the InChIKey of methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate?
The InChIKey is BTTLNOSUGYBSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S/c1-18-11(16)10-7(3-2-4-8(10)13)5-14-9(15)6-19-12(14)17/h2-4H,5-6,13H2,1H3.
What are the key properties of methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate?
methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate has a molecular weight of 280.31 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-6-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoate is sourced from PubChem (CID 104824888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).