2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid

C14H10I3NO3 — CID 104825421

IUPAC2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid
SMILESNc1cccc(COc2c(I)cc(I)cc2I)c1C(=O)O
InChIInChI=1S/C14H10I3NO3/c15-8-4-9(16)13(10(17)5-8)21-6-7-2-1-3-11(18)12(7)14(19)20/h1-5H,6,18H2,(H,19,20)
InChIKeyWMRUOOPKFNMKMD-UHFFFAOYSA-N
MW620.95 g/mol
LogP4.36
Rot. Bonds4

About 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid

2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid (PubChem CID 104825421) has the molecular formula C14H10I3NO3 and a molecular weight of 620.95 g/mol. Its IUPAC name is 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid.

Molecular Properties

Compound Name2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid
PubChem CID104825421
Molecular FormulaC14H10I3NO3
Molecular Weight620.95 g/mol
Exact Mass620.78
IUPAC Name2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid
SMILESNc1cccc(COc2c(I)cc(I)cc2I)c1C(=O)O
InChIInChI=1S/C14H10I3NO3/c15-8-4-9(16)13(10(17)5-8)21-6-7-2-1-3-11(18)12(7)14(19)20/h1-5H,6,18H2,(H,19,20)
InChIKeyWMRUOOPKFNMKMD-UHFFFAOYSA-N
XLogP4.36
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500620.95
LogP ≤ 54.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid?
The IUPAC name of 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid (CID 104825421) is 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid.
What is the SMILES notation for 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid?
The canonical SMILES for 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid is Nc1cccc(COc2c(I)cc(I)cc2I)c1C(=O)O.
What is the InChIKey of 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid?
The InChIKey is WMRUOOPKFNMKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10I3NO3/c15-8-4-9(16)13(10(17)5-8)21-6-7-2-1-3-11(18)12(7)14(19)20/h1-5H,6,18H2,(H,19,20).
What are the key properties of 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid?
2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid has a molecular weight of 620.95 g/mol, XLogP of 4.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid is sourced from PubChem (CID 104825421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).