C14H10I3NO3 — CID 104825421
2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid (PubChem CID 104825421) has the molecular formula C14H10I3NO3 and a molecular weight of 620.95 g/mol. Its IUPAC name is 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid.
| Compound Name | 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 104825421 |
| Molecular Formula | C14H10I3NO3 |
| Molecular Weight | 620.95 g/mol |
| Exact Mass | 620.78 |
| IUPAC Name | 2-amino-6-[(2,4,6-triiodophenoxy)methyl]benzoic acid |
| SMILES | Nc1cccc(COc2c(I)cc(I)cc2I)c1C(=O)O |
| InChI | InChI=1S/C14H10I3NO3/c15-8-4-9(16)13(10(17)5-8)21-6-7-2-1-3-11(18)12(7)14(19)20/h1-5H,6,18H2,(H,19,20) |
| InChIKey | WMRUOOPKFNMKMD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.95 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|