About spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde
spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde (PubChem CID 104826749) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde.
Molecular Properties
| Compound Name | spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde |
| PubChem CID | 104826749 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde |
| SMILES | O=Cc1cc2c(cn1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C11H11NO3/c13-7-8-5-9-10(6-12-8)15-11(14-9)3-1-2-4-11/h5-7H,1-4H2 |
| InChIKey | XOBAJKBGWIFSPW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde?
The IUPAC name of spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde (CID 104826749) is spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde.
What is the SMILES notation for spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde?
The canonical SMILES for spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde is O=Cc1cc2c(cn1)OC1(CCCC1)O2.
What is the InChIKey of spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde?
The InChIKey is XOBAJKBGWIFSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-7-8-5-9-10(6-12-8)15-11(14-9)3-1-2-4-11/h5-7H,1-4H2.
What are the key properties of spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde?
spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde has a molecular weight of 205.21 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[[1,3]dioxolo[4,5-c]pyridine-2,1'-cyclopentane]-6-carbaldehyde is sourced from PubChem (CID 104826749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).