About 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol
2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 104826971) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol |
| PubChem CID | 104826971 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | C=CCNCc1nc(CCO)no1 |
| InChI | InChI=1S/C8H13N3O2/c1-2-4-9-6-8-10-7(3-5-12)11-13-8/h2,9,12H,1,3-6H2 |
| InChIKey | WTUPRNUBHJEBMU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol?
The IUPAC name of 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol (CID 104826971) is 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol.
What is the SMILES notation for 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol?
The canonical SMILES for 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol is C=CCNCc1nc(CCO)no1.
What is the InChIKey of 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol?
The InChIKey is WTUPRNUBHJEBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-2-4-9-6-8-10-7(3-5-12)11-13-8/h2,9,12H,1,3-6H2.
What are the key properties of 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol?
2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol has a molecular weight of 183.21 g/mol, XLogP of -0.12, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]ethanol is sourced from PubChem (CID 104826971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).