C33H30FN3O4 — CID 10482708
N-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10482708) has the molecular formula C33H30FN3O4 and a molecular weight of 551.62 g/mol. Its IUPAC name is N-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10482708 |
| Molecular Formula | C33H30FN3O4 |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | N-[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]-5-fluoro-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(NC(=O)c3cccc4c(=O)c5cccc(F)c5[nH]c34)cc1)CC2 |
| InChI | InChI=1S/C33H30FN3O4/c1-40-28-17-21-14-16-37(19-22(21)18-29(28)41-2)15-13-20-9-11-23(12-10-20)35-33(39)26-7-3-5-24-30(26)36-31-25(32(24)38)6-4-8-27(31)34/h3-12,17-18H,13-16,19H2,1-2H3,(H,35,39)(H,36,38) |
| InChIKey | KHDBCPCFSRZFPT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|