C30H41N5O5 — CID 10482714
tert-butyl N-[(2S)-1-[[(4aS,5R)-2-cyclohexyl-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 10482714) has the molecular formula C30H41N5O5 and a molecular weight of 551.69 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(4aS,5R)-2-cyclohexyl-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(4aS,5R)-2-cyclohexyl-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10482714 |
| Molecular Formula | C30H41N5O5 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(4aS,5R)-2-cyclohexyl-1,3-dioxo-4,4a,5,6,7,8-hexahydropyrido[1,2-c]pyrimidin-5-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H]1CCCN2C(=O)N(C3CCCCC3)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C30H41N5O5/c1-30(2,3)40-28(38)33-24(16-19-18-31-22-13-8-7-12-21(19)22)27(37)32-23-14-9-15-34-25(23)17-26(36)35(29(34)39)20-10-5-4-6-11-20/h7-8,12-13,18,20,23-25,31H,4-6,9-11,14-17H2,1-3H3,(H,32,37)(H,33,38)/t23-,24+,25+/m1/s1 |
| InChIKey | PSRVOMNSTGJQHT-DSITVLBTSA-N |
| XLogP | 4.24 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |