C13H19N3 — CID 104827387
2-amino-3-(3,3-dimethylbutan-2-ylamino)benzonitrile (PubChem CID 104827387) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-amino-3-(3,3-dimethylbutan-2-ylamino)benzonitrile.
| Compound Name | 2-amino-3-(3,3-dimethylbutan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 104827387 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-amino-3-(3,3-dimethylbutan-2-ylamino)benzonitrile |
| SMILES | CC(Nc1cccc(C#N)c1N)C(C)(C)C |
| InChI | InChI=1S/C13H19N3/c1-9(13(2,3)4)16-11-7-5-6-10(8-14)12(11)15/h5-7,9,16H,15H2,1-4H3 |
| InChIKey | HBCSRPAPICLTKP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|