About 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid
5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid (PubChem CID 104827778) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid.
Analyze 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid?
The IUPAC name of 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid (CID 104827778) is 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid.
What is the SMILES notation for 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid?
The canonical SMILES for 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid is CC(NCc1cc(C(=O)O)co1)C(C)(C)C.
What is the InChIKey of 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid?
The InChIKey is DQHLWDKPNIZJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-8(12(2,3)4)13-6-10-5-9(7-16-10)11(14)15/h5,7-8,13H,6H2,1-4H3,(H,14,15).
What are the key properties of 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid?
5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid has a molecular weight of 225.29 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,3-dimethylbutan-2-ylamino)methyl]furan-3-carboxylic acid is sourced from PubChem (CID 104827778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).