C16H20N2O2 — CID 104828568
2-(3,3-dimethylbutan-2-ylamino)quinoline-4-carboxylic acid (PubChem CID 104828568) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-(3,3-dimethylbutan-2-ylamino)quinoline-4-carboxylic acid.
| Compound Name | 2-(3,3-dimethylbutan-2-ylamino)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 104828568 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-(3,3-dimethylbutan-2-ylamino)quinoline-4-carboxylic acid |
| SMILES | CC(Nc1cc(C(=O)O)c2ccccc2n1)C(C)(C)C |
| InChI | InChI=1S/C16H20N2O2/c1-10(16(2,3)4)17-14-9-12(15(19)20)11-7-5-6-8-13(11)18-14/h5-10H,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | KKGBINHCOTUDAF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |