About 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one
5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one (PubChem CID 104828828) has the molecular formula C10H16ClN3O
and a molecular weight of 229.71 g/mol. Its IUPAC name is 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one |
| PubChem CID | 104828828 |
| Molecular Formula | C10H16ClN3O |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one |
| SMILES | CC(Nc1cn[nH]c(=O)c1Cl)C(C)(C)C |
| InChI | InChI=1S/C10H16ClN3O/c1-6(10(2,3)4)13-7-5-12-14-9(15)8(7)11/h5-6H,1-4H3,(H2,13,14,15) |
| InChIKey | DDJFJOXZRNPNNE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one?
The IUPAC name of 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one (CID 104828828) is 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one.
What is the SMILES notation for 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one?
The canonical SMILES for 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one is CC(Nc1cn[nH]c(=O)c1Cl)C(C)(C)C.
What is the InChIKey of 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one?
The InChIKey is DDJFJOXZRNPNNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O/c1-6(10(2,3)4)13-7-5-12-14-9(15)8(7)11/h5-6H,1-4H3,(H2,13,14,15).
What are the key properties of 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one?
5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one has a molecular weight of 229.71 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(3,3-dimethylbutan-2-ylamino)-1H-pyridazin-6-one is sourced from PubChem (CID 104828828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).