C12H24N2O3 — CID 104829242
4-[3,3-dimethylbutan-2-ylcarbamoyl(methyl)amino]butanoic acid (PubChem CID 104829242) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-[3,3-dimethylbutan-2-ylcarbamoyl(methyl)amino]butanoic acid.
| Compound Name | 4-[3,3-dimethylbutan-2-ylcarbamoyl(methyl)amino]butanoic acid |
|---|---|
| PubChem CID | 104829242 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 4-[3,3-dimethylbutan-2-ylcarbamoyl(methyl)amino]butanoic acid |
| SMILES | CC(NC(=O)N(C)CCCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-9(12(2,3)4)13-11(17)14(5)8-6-7-10(15)16/h9H,6-8H2,1-5H3,(H,13,17)(H,15,16) |
| InChIKey | RQJYHTYLDIWBED-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |