C12H22N2S — CID 104829439
3-(3,3-dimethylbutan-2-yl)-4-propan-2-yl-1H-imidazole-2-thione (PubChem CID 104829439) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is 3-(3,3-dimethylbutan-2-yl)-4-propan-2-yl-1H-imidazole-2-thione.
| Compound Name | 3-(3,3-dimethylbutan-2-yl)-4-propan-2-yl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 104829439 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-(3,3-dimethylbutan-2-yl)-4-propan-2-yl-1H-imidazole-2-thione |
| SMILES | CC(C)c1c[nH]c(=S)n1C(C)C(C)(C)C |
| InChI | InChI=1S/C12H22N2S/c1-8(2)10-7-13-11(15)14(10)9(3)12(4,5)6/h7-9H,1-6H3,(H,13,15) |
| InChIKey | WIZJEAKGCYTGIJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|