C32H50O8 — CID 10482974
(2E,6E,20E)-13,14,17,19-tetrahydroxy-7,10,12,19,21,24-hexamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione (PubChem CID 10482974) has the molecular formula C32H50O8 and a molecular weight of 562.74 g/mol. Its IUPAC name is (2E,6E,20E)-13,14,17,19-tetrahydroxy-7,10,12,19,21,24-hexamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione.
| Compound Name | (2E,6E,20E)-13,14,17,19-tetrahydroxy-7,10,12,19,21,24-hexamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione |
|---|---|
| PubChem CID | 10482974 |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (2E,6E,20E)-13,14,17,19-tetrahydroxy-7,10,12,19,21,24-hexamethyl-22-methylidene-9,27-dioxabicyclo[24.1.0]heptacosa-2,6,20-triene-8,15-dione |
| SMILES | C=C1CC(C)CC2OC2/C=C/CC/C=C(\C)C(=O)OC(C)CC(C)C(O)C(O)C(=O)CC(O)CC(C)(O)/C=C/1C |
| InChI | InChI=1S/C32H50O8/c1-19-13-21(3)23(5)17-32(7,38)18-25(33)16-26(34)30(36)29(35)22(4)15-24(6)39-31(37)20(2)11-9-8-10-12-27-28(14-19)40-27/h10-12,17,19,22,24-25,27-30,33,35-36,38H,3,8-9,13-16,18H2,1-2,4-7H3/b12-10+,20-11+,23-17+ |
| InChIKey | GGJNLIITUQBONU-VRHXEODVSA-N |
| XLogP | 4.11 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|