C13H18BrN5 — CID 104829750
2-bromo-5-[1-(3,3-dimethylbutan-2-yl)tetrazol-5-yl]aniline (PubChem CID 104829750) has the molecular formula C13H18BrN5 and a molecular weight of 324.23 g/mol. Its IUPAC name is 2-bromo-5-[1-(3,3-dimethylbutan-2-yl)tetrazol-5-yl]aniline.
| Compound Name | 2-bromo-5-[1-(3,3-dimethylbutan-2-yl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 104829750 |
| Molecular Formula | C13H18BrN5 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-bromo-5-[1-(3,3-dimethylbutan-2-yl)tetrazol-5-yl]aniline |
| SMILES | CC(n1nnnc1-c1ccc(Br)c(N)c1)C(C)(C)C |
| InChI | InChI=1S/C13H18BrN5/c1-8(13(2,3)4)19-12(16-17-18-19)9-5-6-10(14)11(15)7-9/h5-8H,15H2,1-4H3 |
| InChIKey | VFGQQNDTAKMGMP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|