About 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one
9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one (PubChem CID 104830042) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one.
Molecular Properties
| Compound Name | 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one |
| PubChem CID | 104830042 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one |
| SMILES | CC(N1C2CCCC1CC(=O)C2)C(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-10(14(2,3)4)15-11-6-5-7-12(15)9-13(16)8-11/h10-12H,5-9H2,1-4H3 |
| InChIKey | HNWQJVOCILLIQB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
The IUPAC name of 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one (CID 104830042) is 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one.
What is the SMILES notation for 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
The canonical SMILES for 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one is CC(N1C2CCCC1CC(=O)C2)C(C)(C)C.
What is the InChIKey of 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
The InChIKey is HNWQJVOCILLIQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-10(14(2,3)4)15-11-6-5-7-12(15)9-13(16)8-11/h10-12H,5-9H2,1-4H3.
What are the key properties of 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one?
9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one has a molecular weight of 223.36 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,3-dimethylbutan-2-yl)-9-azabicyclo[3.3.1]nonan-3-one is sourced from PubChem (CID 104830042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).