C18H30N2 — CID 104830168
1-(3,3-dimethylbutan-2-yl)-3-methyl-3-phenyl-1,4-diazepane (PubChem CID 104830168) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(3,3-dimethylbutan-2-yl)-3-methyl-3-phenyl-1,4-diazepane.
| Compound Name | 1-(3,3-dimethylbutan-2-yl)-3-methyl-3-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 104830168 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-(3,3-dimethylbutan-2-yl)-3-methyl-3-phenyl-1,4-diazepane |
| SMILES | CC(N1CCCNC(C)(c2ccccc2)C1)C(C)(C)C |
| InChI | InChI=1S/C18H30N2/c1-15(17(2,3)4)20-13-9-12-19-18(5,14-20)16-10-7-6-8-11-16/h6-8,10-11,15,19H,9,12-14H2,1-5H3 |
| InChIKey | XCEZOPULVJRTON-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |