C37H50N4O — CID 10483057
(1S,2R,4R,5Z,12R,13S,16Z)-25-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol (PubChem CID 10483057) has the molecular formula C37H50N4O and a molecular weight of 566.83 g/mol. Its IUPAC name is (1S,2R,4R,5Z,12R,13S,16Z)-25-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol.
| Compound Name | (1S,2R,4R,5Z,12R,13S,16Z)-25-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
|---|---|
| PubChem CID | 10483057 |
| Molecular Formula | C37H50N4O |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.40 |
| IUPAC Name | (1S,2R,4R,5Z,12R,13S,16Z)-25-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-11,22-diazapentacyclo[11.11.2.12,22.02,12.04,11]heptacosa-5,16,25-trien-13-ol |
| SMILES | CN1CCc2c([nH]c3ccccc23)C1C1=C[C@@]2(O)CC/C=C\CCCCN3CC[C@@H]1[C@]1(C[C@@H]4/C=C\CCCCN4[C@H]12)C3 |
| InChI | InChI=1S/C37H50N4O/c1-39-22-17-29-28-15-9-10-16-32(28)38-33(29)34(39)30-25-37(42)19-11-5-2-3-6-12-20-40-23-18-31(30)36(26-40)24-27-14-8-4-7-13-21-41(27)35(36)37/h2,5,8-10,14-16,25,27,31,34-35,38,42H,3-4,6-7,11-13,17-24,26H2,1H3/b5-2-,14-8-/t27-,31-,34?,35+,36-,37-/m0/s1 |
| InChIKey | SXCGYMQYLYUUDT-ZRLGDPAISA-N |
| XLogP | 6.38 |
| TPSA | 45.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|