About 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol
8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104831142) has the molecular formula C10H11BrO3
and a molecular weight of 259.10 g/mol. Its IUPAC name is 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 104831142 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1cc(Br)c2c(c1)C(O)CCO2 |
| InChI | InChI=1S/C10H11BrO3/c1-13-6-4-7-9(12)2-3-14-10(7)8(11)5-6/h4-5,9,12H,2-3H2,1H3 |
| InChIKey | YDAWECUMYZOYIW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol (CID 104831142) is 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol is COc1cc(Br)c2c(c1)C(O)CCO2.
What is the InChIKey of 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is YDAWECUMYZOYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO3/c1-13-6-4-7-9(12)2-3-14-10(7)8(11)5-6/h4-5,9,12H,2-3H2,1H3.
What are the key properties of 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol?
8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 259.10 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-methoxy-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 104831142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).