C13H15ClFN3O — CID 104831258
2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]-3-fluoroaniline (PubChem CID 104831258) has the molecular formula C13H15ClFN3O and a molecular weight of 283.73 g/mol. Its IUPAC name is 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]-3-fluoroaniline.
| Compound Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]-3-fluoroaniline |
|---|---|
| PubChem CID | 104831258 |
| Molecular Formula | C13H15ClFN3O |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methoxy]-3-fluoroaniline |
| SMILES | CCc1nn(C)c(COc2c(N)cccc2F)c1Cl |
| InChI | InChI=1S/C13H15ClFN3O/c1-3-10-12(14)11(18(2)17-10)7-19-13-8(15)5-4-6-9(13)16/h4-6H,3,7,16H2,1-2H3 |
| InChIKey | XYXYIXRWQFWIAQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|