C26H28N4O7S — CID 10483300
1-[3-[[2-(N-(2-anilino-2-oxoethyl)-3-methoxyanilino)-2-oxoethyl]carbamoylamino]phenyl]ethanesulfonic acid (PubChem CID 10483300) has the molecular formula C26H28N4O7S and a molecular weight of 540.60 g/mol. Its IUPAC name is 1-[3-[[2-(N-(2-anilino-2-oxoethyl)-3-methoxyanilino)-2-oxoethyl]carbamoylamino]phenyl]ethanesulfonic acid.
| Compound Name | 1-[3-[[2-(N-(2-anilino-2-oxoethyl)-3-methoxyanilino)-2-oxoethyl]carbamoylamino]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 10483300 |
| Molecular Formula | C26H28N4O7S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 1-[3-[[2-(N-(2-anilino-2-oxoethyl)-3-methoxyanilino)-2-oxoethyl]carbamoylamino]phenyl]ethanesulfonic acid |
| SMILES | COc1cccc(N(CC(=O)Nc2ccccc2)C(=O)CNC(=O)Nc2cccc(C(C)S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C26H28N4O7S/c1-18(38(34,35)36)19-8-6-11-21(14-19)29-26(33)27-16-25(32)30(22-12-7-13-23(15-22)37-2)17-24(31)28-20-9-4-3-5-10-20/h3-15,18H,16-17H2,1-2H3,(H,28,31)(H2,27,29,33)(H,34,35,36) |
| InChIKey | MZAGZKMHBCVGII-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|