C11H17ClN2 — CID 104833946
3-chloro-1-N-pentan-2-ylbenzene-1,2-diamine (PubChem CID 104833946) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 3-chloro-1-N-pentan-2-ylbenzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-pentan-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 104833946 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-chloro-1-N-pentan-2-ylbenzene-1,2-diamine |
| SMILES | CCCC(C)Nc1cccc(Cl)c1N |
| InChI | InChI=1S/C11H17ClN2/c1-3-5-8(2)14-10-7-4-6-9(12)11(10)13/h4,6-8,14H,3,5,13H2,1-2H3 |
| InChIKey | VDZCOUXGWKUSPE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|