C35H29N5O2S — CID 10483413
1,6-bis(4-methoxyphenyl)-3,3a,4-triphenyl-[1,2,4]triazolo[1,5-c]triazole-5-thione (PubChem CID 10483413) has the molecular formula C35H29N5O2S and a molecular weight of 583.72 g/mol. Its IUPAC name is 1,6-bis(4-methoxyphenyl)-3,3a,4-triphenyl-[1,2,4]triazolo[1,5-c]triazole-5-thione.
| Compound Name | 1,6-bis(4-methoxyphenyl)-3,3a,4-triphenyl-[1,2,4]triazolo[1,5-c]triazole-5-thione |
|---|---|
| PubChem CID | 10483413 |
| Molecular Formula | C35H29N5O2S |
| Molecular Weight | 583.72 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 1,6-bis(4-methoxyphenyl)-3,3a,4-triphenyl-[1,2,4]triazolo[1,5-c]triazole-5-thione |
| SMILES | COc1ccc(N2N=C(c3ccccc3)C3(c4ccccc4)N(c4ccccc4)C(=S)N(c4ccc(OC)cc4)N23)cc1 |
| InChI | InChI=1S/C35H29N5O2S/c1-41-31-22-18-29(19-23-31)38-34(43)37(28-16-10-5-11-17-28)35(27-14-8-4-9-15-27)33(26-12-6-3-7-13-26)36-39(40(35)38)30-20-24-32(42-2)25-21-30/h3-25H,1-2H3 |
| InChIKey | QSLDXLFNMLVZMR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 43.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.72 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|