C10H15ClN2O — CID 104834240
3-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,2-diamine (PubChem CID 104834240) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 3-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 104834240 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-chloro-1-N-(2-methoxyethyl)-1-N-methylbenzene-1,2-diamine |
| SMILES | COCCN(C)c1cccc(Cl)c1N |
| InChI | InChI=1S/C10H15ClN2O/c1-13(6-7-14-2)9-5-3-4-8(11)10(9)12/h3-5H,6-7,12H2,1-2H3 |
| InChIKey | XCQYUXDXZOIIOR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|