C12H8ClF3N2 — CID 104834471
3-chloro-1-N-(2,4,5-trifluorophenyl)benzene-1,2-diamine (PubChem CID 104834471) has the molecular formula C12H8ClF3N2 and a molecular weight of 272.66 g/mol. Its IUPAC name is 3-chloro-1-N-(2,4,5-trifluorophenyl)benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-(2,4,5-trifluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 104834471 |
| Molecular Formula | C12H8ClF3N2 |
| Molecular Weight | 272.66 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 3-chloro-1-N-(2,4,5-trifluorophenyl)benzene-1,2-diamine |
| SMILES | Nc1c(Cl)cccc1Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H8ClF3N2/c13-6-2-1-3-10(12(6)17)18-11-5-8(15)7(14)4-9(11)16/h1-5,18H,17H2 |
| InChIKey | TZZPXQWJHXUBTD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|