C12H17ClN2 — CID 104834721
2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)aniline (PubChem CID 104834721) has the molecular formula C12H17ClN2 and a molecular weight of 224.74 g/mol. Its IUPAC name is 2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)aniline.
| Compound Name | 2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)aniline |
|---|---|
| PubChem CID | 104834721 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-chloro-6-(3,3-dimethylpyrrolidin-1-yl)aniline |
| SMILES | CC1(C)CCN(c2cccc(Cl)c2N)C1 |
| InChI | InChI=1S/C12H17ClN2/c1-12(2)6-7-15(8-12)10-5-3-4-9(13)11(10)14/h3-5H,6-8,14H2,1-2H3 |
| InChIKey | FYWTVCMQLAIOBP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|