C11H14ClF3N2 — CID 104834782
3-chloro-1-N-(5,5,5-trifluoropentyl)benzene-1,2-diamine (PubChem CID 104834782) has the molecular formula C11H14ClF3N2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 3-chloro-1-N-(5,5,5-trifluoropentyl)benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-(5,5,5-trifluoropentyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 104834782 |
| Molecular Formula | C11H14ClF3N2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-chloro-1-N-(5,5,5-trifluoropentyl)benzene-1,2-diamine |
| SMILES | Nc1c(Cl)cccc1NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H14ClF3N2/c12-8-4-3-5-9(10(8)16)17-7-2-1-6-11(13,14)15/h3-5,17H,1-2,6-7,16H2 |
| InChIKey | CGMHGOCJPAHUKF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|