C9H11ClN2O — CID 104834830
2-chloro-6-(1,2-oxazolidin-2-yl)aniline (PubChem CID 104834830) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-chloro-6-(1,2-oxazolidin-2-yl)aniline.
| Compound Name | 2-chloro-6-(1,2-oxazolidin-2-yl)aniline |
|---|---|
| PubChem CID | 104834830 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-chloro-6-(1,2-oxazolidin-2-yl)aniline |
| SMILES | Nc1c(Cl)cccc1N1CCCO1 |
| InChI | InChI=1S/C9H11ClN2O/c10-7-3-1-4-8(9(7)11)12-5-2-6-13-12/h1,3-4H,2,5-6,11H2 |
| InChIKey | RZVGRHVJSYNXKK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|