C12H15ClN2S — CID 104836127
7-chloro-3-pentan-2-yl-1H-benzimidazole-2-thione (PubChem CID 104836127) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 7-chloro-3-pentan-2-yl-1H-benzimidazole-2-thione.
| Compound Name | 7-chloro-3-pentan-2-yl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 104836127 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 7-chloro-3-pentan-2-yl-1H-benzimidazole-2-thione |
| SMILES | CCCC(C)n1c(=S)[nH]c2c(Cl)cccc21 |
| InChI | InChI=1S/C12H15ClN2S/c1-3-5-8(2)15-10-7-4-6-9(13)11(10)14-12(15)16/h4,6-8H,3,5H2,1-2H3,(H,14,16) |
| InChIKey | ZMFUXYBBKJUMSX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|