C10H10ClN3OS — CID 104836264
2-(4-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-methylacetamide (PubChem CID 104836264) has the molecular formula C10H10ClN3OS and a molecular weight of 255.73 g/mol. Its IUPAC name is 2-(4-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-methylacetamide.
| Compound Name | 2-(4-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 104836264 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2-(4-chloro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(=S)[nH]c2c(Cl)cccc21 |
| InChI | InChI=1S/C10H10ClN3OS/c1-12-8(15)5-14-7-4-2-3-6(11)9(7)13-10(14)16/h2-4H,5H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | VQZRZICMZSEXDZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|