C23H29ClN6O7S2 — CID 10483738
2-[[1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]pyrazole-5-carbonyl]amino]ethyl hydrogen sulfate (PubChem CID 10483738) has the molecular formula C23H29ClN6O7S2 and a molecular weight of 601.11 g/mol. Its IUPAC name is 2-[[1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]pyrazole-5-carbonyl]amino]ethyl hydrogen sulfate.
| Compound Name | 2-[[1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]pyrazole-5-carbonyl]amino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 10483738 |
| Molecular Formula | C23H29ClN6O7S2 |
| Molecular Weight | 601.11 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 2-[[1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]-3-[(1-propan-2-ylpiperidin-4-yl)carbamoyl]pyrazole-5-carbonyl]amino]ethyl hydrogen sulfate |
| SMILES | CC(C)N1CCC(NC(=O)c2cc(C(=O)NCCOS(=O)(=O)O)n(Cc3cc(-c4ccc(Cl)s4)on3)n2)CC1 |
| InChI | InChI=1S/C23H29ClN6O7S2/c1-14(2)29-8-5-15(6-9-29)26-22(31)17-12-18(23(32)25-7-10-36-39(33,34)35)30(27-17)13-16-11-19(37-28-16)20-3-4-21(24)38-20/h3-4,11-12,14-15H,5-10,13H2,1-2H3,(H,25,32)(H,26,31)(H,33,34,35) |
| InChIKey | AVAGFHKMVTVWEF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 168.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.11 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|