C14H19Cl2N3 — CID 104837914
1-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine (PubChem CID 104837914) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine.
| Compound Name | 1-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine |
|---|---|
| PubChem CID | 104837914 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[4-chloro-2-(chloromethyl)benzimidazol-1-yl]-N,N,2-trimethylpropan-2-amine |
| SMILES | CN(C)C(C)(C)Cn1c(CCl)nc2c(Cl)cccc21 |
| InChI | InChI=1S/C14H19Cl2N3/c1-14(2,18(3)4)9-19-11-7-5-6-10(16)13(11)17-12(19)8-15/h5-7H,8-9H2,1-4H3 |
| InChIKey | IOIFUFPENBXZTK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|