C13H14Cl2N2 — CID 104838040
4-chloro-2-(2-chloroethyl)-1-cyclobutylbenzimidazole (PubChem CID 104838040) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.17 g/mol. Its IUPAC name is 4-chloro-2-(2-chloroethyl)-1-cyclobutylbenzimidazole.
| Compound Name | 4-chloro-2-(2-chloroethyl)-1-cyclobutylbenzimidazole |
|---|---|
| PubChem CID | 104838040 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 4-chloro-2-(2-chloroethyl)-1-cyclobutylbenzimidazole |
| SMILES | ClCCc1nc2c(Cl)cccc2n1C1CCC1 |
| InChI | InChI=1S/C13H14Cl2N2/c14-8-7-12-16-13-10(15)5-2-6-11(13)17(12)9-3-1-4-9/h2,5-6,9H,1,3-4,7-8H2 |
| InChIKey | QCNQXLPHMUAMOE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|