About 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid
4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 104838198) has the molecular formula C11H12N2O2S2
and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 104838198 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CCc1nc(Cc2nc(C)cs2)sc1C(=O)O |
| InChI | InChI=1S/C11H12N2O2S2/c1-3-7-10(11(14)15)17-9(13-7)4-8-12-6(2)5-16-8/h5H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | VZIWIXVBRNDVLQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid (CID 104838198) is 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid is CCc1nc(Cc2nc(C)cs2)sc1C(=O)O.
What is the InChIKey of 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is VZIWIXVBRNDVLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S2/c1-3-7-10(11(14)15)17-9(13-7)4-8-12-6(2)5-16-8/h5H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid?
4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 268.36 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 104838198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).