About 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid
4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 104838251) has the molecular formula C10H13NO3S2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid.
Analyze 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid (CID 104838251) is 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid is CCc1nc(C2CSCCO2)sc1C(=O)O.
What is the InChIKey of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is MFBPKFSRPNIYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S2/c1-2-6-8(10(12)13)16-9(11-6)7-5-15-4-3-14-7/h7H,2-5H2,1H3,(H,12,13).
What are the key properties of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 259.35 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 104838251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).