4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid

C10H13NO3S2 — CID 104838251

IUPAC4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(C2CSCCO2)sc1C(=O)O
InChIInChI=1S/C10H13NO3S2/c1-2-6-8(10(12)13)16-9(11-6)7-5-15-4-3-14-7/h7H,2-5H2,1H3,(H,12,13)
InChIKeyMFBPKFSRPNIYCX-UHFFFAOYSA-N
MW259.35 g/mol
LogP2.21
Rot. Bonds3

About 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid

4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 104838251) has the molecular formula C10H13NO3S2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid
PubChem CID104838251
Molecular FormulaC10H13NO3S2
Molecular Weight259.35 g/mol
Exact Mass259.03
IUPAC Name4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid
SMILESCCc1nc(C2CSCCO2)sc1C(=O)O
InChIInChI=1S/C10H13NO3S2/c1-2-6-8(10(12)13)16-9(11-6)7-5-15-4-3-14-7/h7H,2-5H2,1H3,(H,12,13)
InChIKeyMFBPKFSRPNIYCX-UHFFFAOYSA-N
XLogP2.21
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.35
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid (CID 104838251) is 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid is CCc1nc(C2CSCCO2)sc1C(=O)O.
What is the InChIKey of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is MFBPKFSRPNIYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S2/c1-2-6-8(10(12)13)16-9(11-6)7-5-15-4-3-14-7/h7H,2-5H2,1H3,(H,12,13).
What are the key properties of 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid?
4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 259.35 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(1,4-oxathian-2-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 104838251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).